C46H78NO10P — CID 134779641
(2S)-2-amino-3-[hydroxy-[(2R)-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxy-3-[(E)-icos-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 134779641) has the molecular formula C46H78NO10P and a molecular weight of 836.10 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2R)-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxy-3-[(E)-icos-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2R)-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxy-3-[(E)-icos-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134779641 |
| Molecular Formula | C46H78NO10P |
| Molecular Weight | 836.10 g/mol |
| Exact Mass | 835.54 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2R)-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxy-3-[(E)-icos-11-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C/CCCCCCCC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C46H78NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-44(48)54-39-42(40-55-58(52,53)56-41-43(47)46(50)51)57-45(49)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,12,14,17-20,24,26,30,32,42-43H,3-5,7,9-11,13,15-16,21-23,25,27-29,31,33-41,47H2,1-2H3,(H,50,51)(H,52,53)/b8-6+,14-12+,19-17+,20-18+,26-24+,32-30+/t42-,43+/m1/s1 |
| InChIKey | XSEKIMYCBALMQV-KMWAXHNASA-N |
| XLogP | 11.73 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.10 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|