C50H94NO7+ — CID 134780494
[3-[2,3-bis[[(E)-icos-11-enoyl]oxy]propoxy]-1-carboxypropyl]-trimethylazanium (PubChem CID 134780494) has the molecular formula C50H94NO7+ and a molecular weight of 821.30 g/mol. Its IUPAC name is [3-[2,3-bis[[(E)-icos-11-enoyl]oxy]propoxy]-1-carboxypropyl]-trimethylazanium.
| Compound Name | [3-[2,3-bis[[(E)-icos-11-enoyl]oxy]propoxy]-1-carboxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 134780494 |
| Molecular Formula | C50H94NO7+ |
| Molecular Weight | 821.30 g/mol |
| Exact Mass | 820.70 |
| IUPAC Name | [3-[2,3-bis[[(E)-icos-11-enoyl]oxy]propoxy]-1-carboxypropyl]-trimethylazanium |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCC(=O)OCC(COCCC(C(=O)O)[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C50H93NO7/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-48(52)57-45-46(44-56-43-42-47(50(54)55)51(3,4)5)58-49(53)41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,46-47H,6-19,24-45H2,1-5H3/p+1/b22-20+,23-21+ |
| InChIKey | YAEBZCQZNKGITO-DQPVQCHKSA-O |
| XLogP | 13.64 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.30 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|