C39H74NO8P — CID 134780766
[(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134780766) has the molecular formula C39H74NO8P and a molecular weight of 715.99 g/mol. Its IUPAC name is [(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134780766 |
| Molecular Formula | C39H74NO8P |
| Molecular Weight | 715.99 g/mol |
| Exact Mass | 715.52 |
| IUPAC Name | [(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C39H74NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-39(42)48-37(36-47-49(43,44)46-34-33-40(3,4)5)35-45-38(41)31-29-27-25-23-21-19-17-15-13-11-9-7-2/h15,17,20,22,37H,6-14,16,18-19,21,23-36H2,1-5H3/b17-15+,22-20+/t37-/m1/s1 |
| InChIKey | YCRQMHJBYLKNHA-ZNJJFCQISA-N |
| XLogP | 9.77 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.99 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|