C42H74NO10P — CID 134782149
(2S)-2-amino-3-[hydroxy-[(2R)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-[(E)-octadec-7-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 134782149) has the molecular formula C42H74NO10P and a molecular weight of 784.02 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2R)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-[(E)-octadec-7-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2R)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-[(E)-octadec-7-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134782149 |
| Molecular Formula | C42H74NO10P |
| Molecular Weight | 784.02 g/mol |
| Exact Mass | 783.51 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2R)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-[(E)-octadec-7-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCC/C=C/CCCCCCCCCC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C42H74NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(44)50-35-38(36-51-54(48,49)52-37-39(43)42(46)47)53-41(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,12,14,18,20-21,23,38-39H,3-5,7,9-11,13,15-17,19,22,24-37,43H2,1-2H3,(H,46,47)(H,48,49)/b8-6+,14-12+,20-18+,23-21+/t38-,39+/m1/s1 |
| InChIKey | YPKSWCDEFYQYNJ-MFQMDDKWSA-N |
| XLogP | 10.61 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.02 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|