C48H81NO8P+ — CID 134782670
2-[2,3-bis[[(4Z,7Z,10Z,13Z)-icosa-4,7,10,13-tetraenoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 134782670) has the molecular formula C48H81NO8P+ and a molecular weight of 831.15 g/mol. Its IUPAC name is 2-[2,3-bis[[(4Z,7Z,10Z,13Z)-icosa-4,7,10,13-tetraenoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2,3-bis[[(4Z,7Z,10Z,13Z)-icosa-4,7,10,13-tetraenoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134782670 |
| Molecular Formula | C48H81NO8P+ |
| Molecular Weight | 831.15 g/mol |
| Exact Mass | 830.57 |
| IUPAC Name | 2-[2,3-bis[[(4Z,7Z,10Z,13Z)-icosa-4,7,10,13-tetraenoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC |
| InChI | InChI=1S/C48H80NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-47(50)54-44-46(45-56-58(52,53)55-43-42-49(3,4)5)57-48(51)41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h16-19,22-25,28-31,34-37,46H,6-15,20-21,26-27,32-33,38-45H2,1-5H3/p+1/b18-16-,19-17-,24-22-,25-23-,30-28-,31-29-,36-34-,37-35- |
| InChIKey | KCIQBQCUXASTLU-BABJFZKUSA-O |
| XLogP | 12.57 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.15 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|