C38H65O10P — CID 134783000
[(2R)-1-decanoyloxy-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate (PubChem CID 134783000) has the molecular formula C38H65O10P and a molecular weight of 712.90 g/mol. Its IUPAC name is [(2R)-1-decanoyloxy-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate.
| Compound Name | [(2R)-1-decanoyloxy-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 134783000 |
| Molecular Formula | C38H65O10P |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 712.43 |
| IUPAC Name | [(2R)-1-decanoyloxy-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C38H65O10P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-24-26-28-30-38(42)48-36(34-47-49(43,44)46-32-35(40)31-39)33-45-37(41)29-27-25-23-10-8-6-4-2/h5,7,11-12,14-15,17-18,20-21,35-36,39-40H,3-4,6,8-10,13,16,19,22-34H2,1-2H3,(H,43,44)/b7-5+,12-11+,15-14+,18-17+,21-20+/t35-,36+/m0/s1 |
| InChIKey | YXLIPPMKNAXPOR-RJLSEHKWSA-N |
| XLogP | 8.77 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|