C60H102O6 — CID 134783493
[3-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] (9E,11E,13E)-henicosa-9,11,13-trienoate (PubChem CID 134783493) has the molecular formula C60H102O6 and a molecular weight of 919.47 g/mol. Its IUPAC name is [3-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] (9E,11E,13E)-henicosa-9,11,13-trienoate.
| Compound Name | [3-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] (9E,11E,13E)-henicosa-9,11,13-trienoate |
|---|---|
| PubChem CID | 134783493 |
| Molecular Formula | C60H102O6 |
| Molecular Weight | 919.47 g/mol |
| Exact Mass | 918.77 |
| IUPAC Name | [3-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] (9E,11E,13E)-henicosa-9,11,13-trienoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)OC(COC(=O)CC/C=C/C/C=C/CCCCCCCC)COC(=O)CCCCCCC/C=C/C=C/C=C/CCCCCCC |
| InChI | InChI=1S/C60H102O6/c1-4-7-10-13-16-19-22-25-27-29-31-32-35-38-41-44-47-50-53-59(62)65-56-57(55-64-58(61)52-49-46-43-40-37-34-24-21-18-15-12-9-6-3)66-60(63)54-51-48-45-42-39-36-33-30-28-26-23-20-17-14-11-8-5-2/h17,20,22,25-29,31-32,34,37,43,46,57H,4-16,18-19,21,23-24,30,33,35-36,38-42,44-45,47-56H2,1-3H3/b20-17+,25-22+,28-26+,29-27+,32-31+,37-34+,46-43+ |
| InChIKey | ZBSIRKGDXMXGNQ-OUJIIBBMSA-N |
| XLogP | 18.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.47 |
| LogP ≤ 5 | 18.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|