C41H72NO9P — CID 134783653
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-18-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 134783653) has the molecular formula C41H72NO9P and a molecular weight of 754.00 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-18-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-18-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 134783653 |
| Molecular Formula | C41H72NO9P |
| Molecular Weight | 754.00 g/mol |
| Exact Mass | 753.49 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-18-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCC(O)CC |
| InChI | InChI=1S/C41H72NO9P/c1-3-5-6-7-8-9-10-13-17-20-23-26-29-32-40(44)48-36-39(37-50-52(46,47)49-35-34-42)51-41(45)33-30-27-24-21-18-15-12-11-14-16-19-22-25-28-31-38(43)4-2/h9-10,12,14-16,21-22,24-25,38-39,43H,3-8,11,13,17-20,23,26-37,42H2,1-2H3,(H,46,47)/b10-9-,15-12-,16-14-,24-21-,25-22- |
| InChIKey | ZDCQEGRZBIKTCV-BPTHFSRZSA-N |
| XLogP | 9.91 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.00 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|