About 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid
5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid (PubChem CID 13478393) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid |
| PubChem CID | 13478393 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid |
| SMILES | COc1ccn2ncc(C(=O)O)c2c1 |
| InChI | InChI=1S/C9H8N2O3/c1-14-6-2-3-11-8(4-6)7(5-10-11)9(12)13/h2-5H,1H3,(H,12,13) |
| InChIKey | MYQWMXXRZQCCHN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid?
The IUPAC name of 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid (CID 13478393) is 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid.
What is the SMILES notation for 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid?
The canonical SMILES for 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid is COc1ccn2ncc(C(=O)O)c2c1.
What is the InChIKey of 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid?
The InChIKey is MYQWMXXRZQCCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c1-14-6-2-3-11-8(4-6)7(5-10-11)9(12)13/h2-5H,1H3,(H,12,13).
What are the key properties of 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid?
5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid has a molecular weight of 192.17 g/mol, XLogP of 1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxypyrazolo[1,5-a]pyridine-3-carboxylic acid is sourced from PubChem (CID 13478393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).