6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid

C10H10N2O2 — CID 13478399

IUPAC6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid
SMILESCc1ccc2c(C(=O)O)cnn2c1C
InChIInChI=1S/C10H10N2O2/c1-6-3-4-9-8(10(13)14)5-11-12(9)7(6)2/h3-5H,1-2H3,(H,13,14)
InChIKeyKYNPCXXMNPNXSS-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.65
Rot. Bonds1

About 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid

6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid (PubChem CID 13478399) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid
PubChem CID13478399
Molecular FormulaC10H10N2O2
Molecular Weight190.20 g/mol
Exact Mass190.07
IUPAC Name6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid
SMILESCc1ccc2c(C(=O)O)cnn2c1C
InChIInChI=1S/C10H10N2O2/c1-6-3-4-9-8(10(13)14)5-11-12(9)7(6)2/h3-5H,1-2H3,(H,13,14)
InChIKeyKYNPCXXMNPNXSS-UHFFFAOYSA-N
XLogP1.65
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid?
The IUPAC name of 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid (CID 13478399) is 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid.
What is the SMILES notation for 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid?
The canonical SMILES for 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid is Cc1ccc2c(C(=O)O)cnn2c1C.
What is the InChIKey of 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid?
The InChIKey is KYNPCXXMNPNXSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-6-3-4-9-8(10(13)14)5-11-12(9)7(6)2/h3-5H,1-2H3,(H,13,14).
What are the key properties of 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid?
6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid has a molecular weight of 190.20 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid is sourced from PubChem (CID 13478399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).