C15H15N3OS — CID 13478593
N-prop-2-enyl-5-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide (PubChem CID 13478593) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is N-prop-2-enyl-5-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide.
| Compound Name | N-prop-2-enyl-5-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide |
|---|---|
| PubChem CID | 13478593 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-prop-2-enyl-5-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide |
| SMILES | C=CCNC(=O)c1cc(-c2cccnc2)n2c1CSC2 |
| InChI | InChI=1S/C15H15N3OS/c1-2-5-17-15(19)12-7-13(11-4-3-6-16-8-11)18-10-20-9-14(12)18/h2-4,6-8H,1,5,9-10H2,(H,17,19) |
| InChIKey | IYGDHQMSSRJINJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|