C21H28N2O5 — CID 134786217
3-O-butyl 1-O-ethyl (1R,3aS,9bS)-3a,5-dimethyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate (PubChem CID 134786217) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is 3-O-butyl 1-O-ethyl (1R,3aS,9bS)-3a,5-dimethyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate.
| Compound Name | 3-O-butyl 1-O-ethyl (1R,3aS,9bS)-3a,5-dimethyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 134786217 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 3-O-butyl 1-O-ethyl (1R,3aS,9bS)-3a,5-dimethyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate |
| SMILES | CCCCOC(=O)N1C[C@H](C(=O)OCC)[C@H]2c3ccccc3N(C)C(=O)[C@]21C |
| InChI | InChI=1S/C21H28N2O5/c1-5-7-12-28-20(26)23-13-15(18(24)27-6-2)17-14-10-8-9-11-16(14)22(4)19(25)21(17,23)3/h8-11,15,17H,5-7,12-13H2,1-4H3/t15-,17+,21-/m0/s1 |
| InChIKey | CBLDNFVEMJPIAO-XPIZARPCSA-N |
| XLogP | 2.94 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|