C24H30N2O5 — CID 134786294
3-O-but-3-enyl 1-O-ethyl (1R,3aS,9bS)-5-(cyclopropylmethyl)-3a-methyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate (PubChem CID 134786294) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-O-but-3-enyl 1-O-ethyl (1R,3aS,9bS)-5-(cyclopropylmethyl)-3a-methyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate.
| Compound Name | 3-O-but-3-enyl 1-O-ethyl (1R,3aS,9bS)-5-(cyclopropylmethyl)-3a-methyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 134786294 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 3-O-but-3-enyl 1-O-ethyl (1R,3aS,9bS)-5-(cyclopropylmethyl)-3a-methyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate |
| SMILES | C=CCCOC(=O)N1C[C@H](C(=O)OCC)[C@H]2c3ccccc3N(CC3CC3)C(=O)[C@]21C |
| InChI | InChI=1S/C24H30N2O5/c1-4-6-13-31-23(29)26-15-18(21(27)30-5-2)20-17-9-7-8-10-19(17)25(14-16-11-12-16)22(28)24(20,26)3/h4,7-10,16,18,20H,1,5-6,11-15H2,2-3H3/t18-,20+,24-/m0/s1 |
| InChIKey | PYTZLSTWEHTBAJ-NRYAXDJKSA-N |
| XLogP | 3.49 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|