C19H23NO3S — CID 134786393
(4S,5R)-1-oxido-4-(phenoxymethyl)-5-phenyl-2-propan-2-yl-4,5-dihydro-3H-1,2-thiazole 1-oxide (PubChem CID 134786393) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is (4S,5R)-1-oxido-4-(phenoxymethyl)-5-phenyl-2-propan-2-yl-4,5-dihydro-3H-1,2-thiazole 1-oxide.
| Compound Name | (4S,5R)-1-oxido-4-(phenoxymethyl)-5-phenyl-2-propan-2-yl-4,5-dihydro-3H-1,2-thiazole 1-oxide |
|---|---|
| PubChem CID | 134786393 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (4S,5R)-1-oxido-4-(phenoxymethyl)-5-phenyl-2-propan-2-yl-4,5-dihydro-3H-1,2-thiazole 1-oxide |
| SMILES | CC(C)N1C[C@@H](COc2ccccc2)[C@H](c2ccccc2)[S+]1(=O)[O-] |
| InChI | InChI=1S/C19H23NO3S/c1-15(2)20-13-17(14-23-18-11-7-4-8-12-18)19(24(20,21)22)16-9-5-3-6-10-16/h3-12,15,17,19H,13-14H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | DYVIYZVBIZTEQW-HKUYNNGSSA-N |
| XLogP | 3.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|