C24H32N2O5 — CID 134786398
1-O-ethyl 3-O-(2-methylpropyl) (1R,3aS,9bS)-5-(cyclopropylmethyl)-3a-methyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate (PubChem CID 134786398) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-O-ethyl 3-O-(2-methylpropyl) (1R,3aS,9bS)-5-(cyclopropylmethyl)-3a-methyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate.
| Compound Name | 1-O-ethyl 3-O-(2-methylpropyl) (1R,3aS,9bS)-5-(cyclopropylmethyl)-3a-methyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 134786398 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-O-ethyl 3-O-(2-methylpropyl) (1R,3aS,9bS)-5-(cyclopropylmethyl)-3a-methyl-4-oxo-2,9b-dihydro-1H-pyrrolo[2,3-c]quinoline-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CN(C(=O)OCC(C)C)[C@]2(C)C(=O)N(CC3CC3)c3ccccc3[C@H]12 |
| InChI | InChI=1S/C24H32N2O5/c1-5-30-21(27)18-13-26(23(29)31-14-15(2)3)24(4)20(18)17-8-6-7-9-19(17)25(22(24)28)12-16-10-11-16/h6-9,15-16,18,20H,5,10-14H2,1-4H3/t18-,20+,24-/m0/s1 |
| InChIKey | OZSJGKSHBHGDAN-NRYAXDJKSA-N |
| XLogP | 3.57 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |