C22H23NO5 — CID 134786583
ethyl (3R,3aS,8bS)-1-[2-(4-methoxyphenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate (PubChem CID 134786583) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl (3R,3aS,8bS)-1-[2-(4-methoxyphenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate.
| Compound Name | ethyl (3R,3aS,8bS)-1-[2-(4-methoxyphenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134786583 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl (3R,3aS,8bS)-1-[2-(4-methoxyphenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(C(=O)Cc2ccc(OC)cc2)[C@H]2c3ccccc3O[C@@H]12 |
| InChI | InChI=1S/C22H23NO5/c1-3-27-22(25)17-13-23(19(24)12-14-8-10-15(26-2)11-9-14)20-16-6-4-5-7-18(16)28-21(17)20/h4-11,17,20-21H,3,12-13H2,1-2H3/t17-,20+,21+/m1/s1 |
| InChIKey | MWRFBWKLWTZDPU-QMMLZNLJSA-N |
| XLogP | 2.76 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |