About CID 134786605
CID 134786605 (PubChem CID 134786605) has the molecular formula C13H16FNO4S
and a molecular weight of 301.34 g/mol.
Molecular Properties
| Compound Name | CID 134786605 |
| PubChem CID | 134786605 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | — |
| SMILES | CC[S+](=O)([O-])N1C[C@@H](CO)[C@@H]2Oc3c(F)cccc3[C@@H]21 |
| InChI | InChI=1S/C13H16FNO4S/c1-2-20(17,18)15-6-8(7-16)12-11(15)9-4-3-5-10(14)13(9)19-12/h3-5,8,11-12,16H,2,6-7H2,1H3/t8-,11-,12-/m0/s1 |
| InChIKey | NECSZPWOMMVCCE-UWJYBYFXSA-N |
| XLogP | 1.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 134786605 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134786605?
The IUPAC name of CID 134786605 (CID 134786605) is not available.
What is the SMILES notation for CID 134786605?
The canonical SMILES for CID 134786605 is CC[S+](=O)([O-])N1C[C@@H](CO)[C@@H]2Oc3c(F)cccc3[C@@H]21.
What is the InChIKey of CID 134786605?
The InChIKey is NECSZPWOMMVCCE-UWJYBYFXSA-N. The full InChI is InChI=1S/C13H16FNO4S/c1-2-20(17,18)15-6-8(7-16)12-11(15)9-4-3-5-10(14)13(9)19-12/h3-5,8,11-12,16H,2,6-7H2,1H3/t8-,11-,12-/m0/s1.
What are the key properties of CID 134786605?
CID 134786605 has a molecular weight of 301.34 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134786605 is sourced from PubChem (CID 134786605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).