C24H29NO2 — CID 134786772
(3S,4aS,6S,7aS)-N-benzyl-N-(oxetan-3-yl)-3-phenyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-6-amine (PubChem CID 134786772) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (3S,4aS,6S,7aS)-N-benzyl-N-(oxetan-3-yl)-3-phenyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-6-amine.
| Compound Name | (3S,4aS,6S,7aS)-N-benzyl-N-(oxetan-3-yl)-3-phenyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-6-amine |
|---|---|
| PubChem CID | 134786772 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (3S,4aS,6S,7aS)-N-benzyl-N-(oxetan-3-yl)-3-phenyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-6-amine |
| SMILES | c1ccc(CN(C2COC2)[C@@H]2C[C@@H]3CO[C@H](c4ccccc4)C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C24H29NO2/c1-3-7-18(8-4-1)14-25(23-16-26-17-23)22-11-20-13-24(27-15-21(20)12-22)19-9-5-2-6-10-19/h1-10,20-24H,11-17H2/t20-,21+,22-,24-/m0/s1 |
| InChIKey | QBLKUOSGCSZLKD-KHUIQGCPSA-N |
| XLogP | 4.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |