C24H34N2O5 — CID 134786788
ethyl (3R,4S)-1-benzyl-8-hexanoyl-3-hydroxy-2-oxo-1,8-diazaspiro[4.5]decane-4-carboxylate (PubChem CID 134786788) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is ethyl (3R,4S)-1-benzyl-8-hexanoyl-3-hydroxy-2-oxo-1,8-diazaspiro[4.5]decane-4-carboxylate.
| Compound Name | ethyl (3R,4S)-1-benzyl-8-hexanoyl-3-hydroxy-2-oxo-1,8-diazaspiro[4.5]decane-4-carboxylate |
|---|---|
| PubChem CID | 134786788 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | ethyl (3R,4S)-1-benzyl-8-hexanoyl-3-hydroxy-2-oxo-1,8-diazaspiro[4.5]decane-4-carboxylate |
| SMILES | CCCCCC(=O)N1CCC2(CC1)[C@H](C(=O)OCC)[C@@H](O)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C24H34N2O5/c1-3-5-7-12-19(27)25-15-13-24(14-16-25)20(23(30)31-4-2)21(28)22(29)26(24)17-18-10-8-6-9-11-18/h6,8-11,20-21,28H,3-5,7,12-17H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | QTYIEABRRSODFI-LEWJYISDSA-N |
| XLogP | 2.51 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|