C20H20FNO4 — CID 134786921
1-[(3S,3aS,8bS)-5-fluoro-3-(hydroxymethyl)-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrol-1-yl]-2-(4-methoxyphenyl)ethanone (PubChem CID 134786921) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is 1-[(3S,3aS,8bS)-5-fluoro-3-(hydroxymethyl)-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrol-1-yl]-2-(4-methoxyphenyl)ethanone.
| Compound Name | 1-[(3S,3aS,8bS)-5-fluoro-3-(hydroxymethyl)-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrol-1-yl]-2-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 134786921 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-[(3S,3aS,8bS)-5-fluoro-3-(hydroxymethyl)-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrol-1-yl]-2-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2C[C@@H](CO)[C@@H]3Oc4c(F)cccc4[C@@H]32)cc1 |
| InChI | InChI=1S/C20H20FNO4/c1-25-14-7-5-12(6-8-14)9-17(24)22-10-13(11-23)19-18(22)15-3-2-4-16(21)20(15)26-19/h2-8,13,18-19,23H,9-11H2,1H3/t13-,18-,19-/m0/s1 |
| InChIKey | RMQQRBGTSPYKGB-AGRHKRQWSA-N |
| XLogP | 2.33 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |