C16H21N3O3 — CID 134786967
methyl (7S,8R,8aS)-7-carbamoyl-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate (PubChem CID 134786967) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl (7S,8R,8aS)-7-carbamoyl-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate.
| Compound Name | methyl (7S,8R,8aS)-7-carbamoyl-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 134786967 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | methyl (7S,8R,8aS)-7-carbamoyl-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
| SMILES | COC(=O)N1CCN2C[C@@H](C(N)=O)[C@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C16H21N3O3/c1-22-16(21)19-8-7-18-9-12(15(17)20)14(13(18)10-19)11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3,(H2,17,20)/t12-,13-,14+/m1/s1 |
| InChIKey | KNTHTEBEUHYZNF-MCIONIFRSA-N |
| XLogP | 0.64 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |