C26H36N2O5 — CID 134786980
ethyl (2R,3S,5S)-10-(2-methoxyethyl)-11-oxo-1-pent-4-enoyl-2-phenyl-1,10-diazaspiro[4.6]undecane-3-carboxylate (PubChem CID 134786980) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is ethyl (2R,3S,5S)-10-(2-methoxyethyl)-11-oxo-1-pent-4-enoyl-2-phenyl-1,10-diazaspiro[4.6]undecane-3-carboxylate.
| Compound Name | ethyl (2R,3S,5S)-10-(2-methoxyethyl)-11-oxo-1-pent-4-enoyl-2-phenyl-1,10-diazaspiro[4.6]undecane-3-carboxylate |
|---|---|
| PubChem CID | 134786980 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | ethyl (2R,3S,5S)-10-(2-methoxyethyl)-11-oxo-1-pent-4-enoyl-2-phenyl-1,10-diazaspiro[4.6]undecane-3-carboxylate |
| SMILES | C=CCCC(=O)N1[C@@H](c2ccccc2)[C@@H](C(=O)OCC)C[C@]12CCCCN(CCOC)C2=O |
| InChI | InChI=1S/C26H36N2O5/c1-4-6-14-22(29)28-23(20-12-8-7-9-13-20)21(24(30)33-5-2)19-26(28)15-10-11-16-27(25(26)31)17-18-32-3/h4,7-9,12-13,21,23H,1,5-6,10-11,14-19H2,2-3H3/t21-,23-,26-/m0/s1 |
| InChIKey | IWTKCKSQNHQZSQ-KJOQGJGQSA-N |
| XLogP | 3.50 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|