C23H25NO6 — CID 134787011
ethyl (3R,3aS,8bS)-6-methoxy-1-[2-(4-methoxyphenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate (PubChem CID 134787011) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is ethyl (3R,3aS,8bS)-6-methoxy-1-[2-(4-methoxyphenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate.
| Compound Name | ethyl (3R,3aS,8bS)-6-methoxy-1-[2-(4-methoxyphenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134787011 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | ethyl (3R,3aS,8bS)-6-methoxy-1-[2-(4-methoxyphenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(C(=O)Cc2ccc(OC)cc2)[C@H]2c3ccc(OC)cc3O[C@@H]12 |
| InChI | InChI=1S/C23H25NO6/c1-4-29-23(26)18-13-24(20(25)11-14-5-7-15(27-2)8-6-14)21-17-10-9-16(28-3)12-19(17)30-22(18)21/h5-10,12,18,21-22H,4,11,13H2,1-3H3/t18-,21+,22+/m1/s1 |
| InChIKey | CKYQADVBZUYYHM-COPCDDAFSA-N |
| XLogP | 2.77 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |