C26H30N2O6 — CID 134787047
diethyl (1R,2S,3aS,9bS)-5-(2-methoxyethyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1,3-dicarboxylate (PubChem CID 134787047) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is diethyl (1R,2S,3aS,9bS)-5-(2-methoxyethyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1,3-dicarboxylate.
| Compound Name | diethyl (1R,2S,3aS,9bS)-5-(2-methoxyethyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 134787047 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | diethyl (1R,2S,3aS,9bS)-5-(2-methoxyethyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2c3ccccc3N(CCOC)C(=O)[C@H]2N(C(=O)OCC)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H30N2O6/c1-4-33-25(30)21-20-18-13-9-10-14-19(18)27(15-16-32-3)24(29)23(20)28(26(31)34-5-2)22(21)17-11-7-6-8-12-17/h6-14,20-23H,4-5,15-16H2,1-3H3/t20-,21-,22-,23+/m1/s1 |
| InChIKey | ILQDUHJCFVNQGB-ODAXIHTASA-N |
| XLogP | 3.52 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |