C21H26N2O4 — CID 134787051
but-3-enyl (1S,10R)-13-oxo-12-prop-2-enyl-8-oxa-12,16-diazatricyclo[8.6.0.02,7]hexadeca-2,4,6-triene-16-carboxylate (PubChem CID 134787051) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is but-3-enyl (1S,10R)-13-oxo-12-prop-2-enyl-8-oxa-12,16-diazatricyclo[8.6.0.02,7]hexadeca-2,4,6-triene-16-carboxylate.
| Compound Name | but-3-enyl (1S,10R)-13-oxo-12-prop-2-enyl-8-oxa-12,16-diazatricyclo[8.6.0.02,7]hexadeca-2,4,6-triene-16-carboxylate |
|---|---|
| PubChem CID | 134787051 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | but-3-enyl (1S,10R)-13-oxo-12-prop-2-enyl-8-oxa-12,16-diazatricyclo[8.6.0.02,7]hexadeca-2,4,6-triene-16-carboxylate |
| SMILES | C=CCCOC(=O)N1CCC(=O)N(CC=C)C[C@H]2COc3ccccc3[C@H]21 |
| InChI | InChI=1S/C21H26N2O4/c1-3-5-13-26-21(25)23-12-10-19(24)22(11-4-2)14-16-15-27-18-9-7-6-8-17(18)20(16)23/h3-4,6-9,16,20H,1-2,5,10-15H2/t16-,20-/m0/s1 |
| InChIKey | MSIXINKMJDYLAV-JXFKEZNVSA-N |
| XLogP | 3.17 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|