C28H34N2O5 — CID 134787068
ethyl (1R,2S,3aS,9bS)-5-(2-methoxyethyl)-3-(3-methylbutanoyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1-carboxylate (PubChem CID 134787068) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is ethyl (1R,2S,3aS,9bS)-5-(2-methoxyethyl)-3-(3-methylbutanoyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1-carboxylate.
| Compound Name | ethyl (1R,2S,3aS,9bS)-5-(2-methoxyethyl)-3-(3-methylbutanoyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 134787068 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | ethyl (1R,2S,3aS,9bS)-5-(2-methoxyethyl)-3-(3-methylbutanoyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2c3ccccc3N(CCOC)C(=O)[C@H]2N(C(=O)CC(C)C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H34N2O5/c1-5-35-28(33)24-23-20-13-9-10-14-21(20)29(15-16-34-4)27(32)26(23)30(22(31)17-18(2)3)25(24)19-11-7-6-8-12-19/h6-14,18,23-26H,5,15-17H2,1-4H3/t23-,24-,25-,26+/m1/s1 |
| InChIKey | YAXVXCXFZHBTJD-POTDNYQPSA-N |
| XLogP | 3.94 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |