C20H36N2O3 — CID 134787159
2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-propan-2-ylpropanamide (PubChem CID 134787159) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-propan-2-ylpropanamide.
| Compound Name | 2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 134787159 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 2-[(1S,2S,4aS,7S,8S,8aS)-7-acetamido-1-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-propan-2-ylpropanamide |
| SMILES | CC(=O)N[C@H]1CC[C@]2(C)CC[C@@H](C(C)C(=O)NC(C)C)[C@H](O)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C20H36N2O3/c1-11(2)21-19(25)12(3)15-7-9-20(6)10-8-16(22-14(5)23)13(4)17(20)18(15)24/h11-13,15-18,24H,7-10H2,1-6H3,(H,21,25)(H,22,23)/t12?,13-,15+,16+,17-,18+,20+/m1/s1 |
| InChIKey | ZFKXNBKKSJPZIT-IFOPASGOSA-N |
| XLogP | 2.48 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |