C23H23N7O3S — CID 134787297
CID 134787297 (PubChem CID 134787297) has the molecular formula C23H23N7O3S and a molecular weight of 477.55 g/mol.
| Compound Name | CID 134787297 |
|---|---|
| PubChem CID | 134787297 |
| Molecular Formula | C23H23N7O3S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | — |
| SMILES | Cn1ncc2c(-c3ccc([S+](C)(=O)[O-])cc3)cc(C(=O)N3CCN(c4ncccn4)CC3)nc21 |
| InChI | InChI=1S/C23H23N7O3S/c1-28-21-19(15-26-28)18(16-4-6-17(7-5-16)34(2,32)33)14-20(27-21)22(31)29-10-12-30(13-11-29)23-24-8-3-9-25-23/h3-9,14-15H,10-13H2,1-2H3 |
| InChIKey | TVZZRDGYIFKPRK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 120.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|