C16H14ClN5O — CID 134787455
[1-(6-chloro-3-pyridinyl)imidazo[1,5-a]pyrazin-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 134787455) has the molecular formula C16H14ClN5O and a molecular weight of 327.77 g/mol. Its IUPAC name is [1-(6-chloro-3-pyridinyl)imidazo[1,5-a]pyrazin-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-(6-chloro-3-pyridinyl)imidazo[1,5-a]pyrazin-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 134787455 |
| Molecular Formula | C16H14ClN5O |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | [1-(6-chloro-3-pyridinyl)imidazo[1,5-a]pyrazin-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1nc(-c2ccc(Cl)nc2)c2cnccn12)N1CCCC1 |
| InChI | InChI=1S/C16H14ClN5O/c17-13-4-3-11(9-19-13)14-12-10-18-5-8-22(12)15(20-14)16(23)21-6-1-2-7-21/h3-5,8-10H,1-2,6-7H2 |
| InChIKey | DMRQLWMUBKVVJO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|