C18H19N3O4S — CID 134787513
CID 134787513 (PubChem CID 134787513) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol.
| Compound Name | CID 134787513 |
|---|---|
| PubChem CID | 134787513 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | — |
| SMILES | O=C(c1cccnc1)N1CCCC2(COc3ccccc3[S+](=O)([O-])N2)C1 |
| InChI | InChI=1S/C18H19N3O4S/c22-17(14-5-3-9-19-11-14)21-10-4-8-18(12-21)13-25-15-6-1-2-7-16(15)26(23,24)20-18/h1-3,5-7,9,11H,4,8,10,12-13H2,(H-,20,23,24) |
| InChIKey | MCDDOTKSFYSROR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|