C14H19N3O4S — CID 134787576
1-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)-2-methylpropan-1-one (PubChem CID 134787576) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is 1-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)-2-methylpropan-1-one.
| Compound Name | 1-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 134787576 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCC2(COc3ncccc3S(=O)(=O)N2)C1 |
| InChI | InChI=1S/C14H19N3O4S/c1-10(2)13(18)17-7-5-14(8-17)9-21-12-11(4-3-6-15-12)22(19,20)16-14/h3-4,6,10,16H,5,7-9H2,1-2H3 |
| InChIKey | IWSDAFWDODEUBT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |