C13H17N5O2S — CID 134787656
CID 134787656 (PubChem CID 134787656) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol.
| Compound Name | CID 134787656 |
|---|---|
| PubChem CID | 134787656 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])N1CCn2c(nnc2C(N)c2ccccc2)C1 |
| InChI | InChI=1S/C13H17N5O2S/c1-21(19,20)17-7-8-18-11(9-17)15-16-13(18)12(14)10-5-3-2-4-6-10/h2-6,12H,7-9,14H2,1H3 |
| InChIKey | COFJOULUTJIFEA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|