About 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one
1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one (PubChem CID 134787839) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one |
| PubChem CID | 134787839 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2ccccc2CC12CCCN2C1COC1 |
| InChI | InChI=1S/C15H18N2O2/c18-14-15(6-3-7-17(15)12-9-19-10-12)8-11-4-1-2-5-13(11)16-14/h1-2,4-5,12H,3,6-10H2,(H,16,18) |
| InChIKey | OXUFKTZRZLAACU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one?
The IUPAC name of 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one (CID 134787839) is 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one.
What is the SMILES notation for 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one?
The canonical SMILES for 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one is O=C1Nc2ccccc2CC12CCCN2C1COC1.
What is the InChIKey of 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one?
The InChIKey is OXUFKTZRZLAACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2/c18-14-15(6-3-7-17(15)12-9-19-10-12)8-11-4-1-2-5-13(11)16-14/h1-2,4-5,12H,3,6-10H2,(H,16,18).
What are the key properties of 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one?
1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one has a molecular weight of 258.32 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(oxetan-3-yl)spiro[1,4-dihydroquinoline-3,2'-pyrrolidine]-2-one is sourced from PubChem (CID 134787839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).