About 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide
1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide (PubChem CID 134787988) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide.
Molecular Properties
| Compound Name | 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide |
| PubChem CID | 134787988 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide |
| SMILES | CN(C)C(=O)c1nc(C(C)(C)C)c2cnccn12 |
| InChI | InChI=1S/C13H18N4O/c1-13(2,3)10-9-8-14-6-7-17(9)11(15-10)12(18)16(4)5/h6-8H,1-5H3 |
| InChIKey | XBFRQJZOCVOLFZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide?
The IUPAC name of 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide (CID 134787988) is 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide.
What is the SMILES notation for 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide?
The canonical SMILES for 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide is CN(C)C(=O)c1nc(C(C)(C)C)c2cnccn12.
What is the InChIKey of 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide?
The InChIKey is XBFRQJZOCVOLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O/c1-13(2,3)10-9-8-14-6-7-17(9)11(15-10)12(18)16(4)5/h6-8H,1-5H3.
What are the key properties of 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide?
1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide has a molecular weight of 246.31 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-N,N-dimethylimidazo[1,5-a]pyrazine-3-carboxamide is sourced from PubChem (CID 134787988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).