C16H26N6O2 — CID 134788163
4-(2-methoxyethylamino)-9-methyl-6-piperidin-4-yl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one (PubChem CID 134788163) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-(2-methoxyethylamino)-9-methyl-6-piperidin-4-yl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one.
| Compound Name | 4-(2-methoxyethylamino)-9-methyl-6-piperidin-4-yl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 134788163 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 4-(2-methoxyethylamino)-9-methyl-6-piperidin-4-yl-5,8-dihydropyrimido[4,5-e][1,4]diazepin-7-one |
| SMILES | COCCNc1ncnc2c1CN(C1CCNCC1)C(=O)CN2C |
| InChI | InChI=1S/C16H26N6O2/c1-21-10-14(23)22(12-3-5-17-6-4-12)9-13-15(18-7-8-24-2)19-11-20-16(13)21/h11-12,17H,3-10H2,1-2H3,(H,18,19,20) |
| InChIKey | DPINXLRBAFJFEX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|