About 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one
2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one (PubChem CID 134788222) has the molecular formula C17H19N3OS
and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one |
| PubChem CID | 134788222 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one |
| SMILES | O=C1c2ccccc2CN1C1CCN(Cc2cncs2)CC1 |
| InChI | InChI=1S/C17H19N3OS/c21-17-16-4-2-1-3-13(16)10-20(17)14-5-7-19(8-6-14)11-15-9-18-12-22-15/h1-4,9,12,14H,5-8,10-11H2 |
| InChIKey | MURAGWQONQUAQU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one?
The IUPAC name of 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one (CID 134788222) is 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one.
What is the SMILES notation for 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one?
The canonical SMILES for 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one is O=C1c2ccccc2CN1C1CCN(Cc2cncs2)CC1.
What is the InChIKey of 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one?
The InChIKey is MURAGWQONQUAQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3OS/c21-17-16-4-2-1-3-13(16)10-20(17)14-5-7-19(8-6-14)11-15-9-18-12-22-15/h1-4,9,12,14H,5-8,10-11H2.
What are the key properties of 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one?
2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one has a molecular weight of 313.43 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]-3H-isoindol-1-one is sourced from PubChem (CID 134788222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).