About CID 134788241
CID 134788241 (PubChem CID 134788241) has the molecular formula C19H20FN3O4S
and a molecular weight of 405.45 g/mol.
Molecular Properties
| Compound Name | CID 134788241 |
| PubChem CID | 134788241 |
| Molecular Formula | C19H20FN3O4S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | — |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCC2(CC1)CN[S+](=O)([O-])c1cccnc1O2 |
| InChI | InChI=1S/C19H20FN3O4S/c20-15-5-3-14(4-6-15)12-17(24)23-10-7-19(8-11-23)13-22-28(25,26)16-2-1-9-21-18(16)27-19/h1-6,9H,7-8,10-13H2,(H-,22,25,26) |
| InChIKey | SNVZRCBJFTYIHH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 134788241 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134788241?
The IUPAC name of CID 134788241 (CID 134788241) is not available.
What is the SMILES notation for CID 134788241?
The canonical SMILES for CID 134788241 is O=C(Cc1ccc(F)cc1)N1CCC2(CC1)CN[S+](=O)([O-])c1cccnc1O2.
What is the InChIKey of CID 134788241?
The InChIKey is SNVZRCBJFTYIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3O4S/c20-15-5-3-14(4-6-15)12-17(24)23-10-7-19(8-11-23)13-22-28(25,26)16-2-1-9-21-18(16)27-19/h1-6,9H,7-8,10-13H2,(H-,22,25,26).
What are the key properties of CID 134788241?
CID 134788241 has a molecular weight of 405.45 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134788241 is sourced from PubChem (CID 134788241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).