About CID 134788245
CID 134788245 (PubChem CID 134788245) has the molecular formula C16H18N4O3S
and a molecular weight of 346.41 g/mol.
Molecular Properties
| Compound Name | CID 134788245 |
| PubChem CID | 134788245 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | — |
| SMILES | O=[S+]1([O-])NC2(CCN(Cc3ccncc3)C2)COc2ccncc21 |
| InChI | InChI=1S/C16H18N4O3S/c21-24(22)15-9-18-7-3-14(15)23-12-16(19-24)4-8-20(11-16)10-13-1-5-17-6-2-13/h1-3,5-7,9H,4,8,10-12H2,(H-,19,21,22) |
| InChIKey | LYUDHSDGSGHGID-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 134788245 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134788245?
The IUPAC name of CID 134788245 (CID 134788245) is not available.
What is the SMILES notation for CID 134788245?
The canonical SMILES for CID 134788245 is O=[S+]1([O-])NC2(CCN(Cc3ccncc3)C2)COc2ccncc21.
What is the InChIKey of CID 134788245?
The InChIKey is LYUDHSDGSGHGID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O3S/c21-24(22)15-9-18-7-3-14(15)23-12-16(19-24)4-8-20(11-16)10-13-1-5-17-6-2-13/h1-3,5-7,9H,4,8,10-12H2,(H-,19,21,22).
What are the key properties of CID 134788245?
CID 134788245 has a molecular weight of 346.41 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134788245 is sourced from PubChem (CID 134788245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).