About 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone
1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone (PubChem CID 134788788) has the molecular formula C18H24N2O2
and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone |
| PubChem CID | 134788788 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone |
| SMILES | CC(=O)N1CC2(CCCN(C3COC3)C2)Cc2ccccc21 |
| InChI | InChI=1S/C18H24N2O2/c1-14(21)20-13-18(9-15-5-2-3-6-17(15)20)7-4-8-19(12-18)16-10-22-11-16/h2-3,5-6,16H,4,7-13H2,1H3 |
| InChIKey | WGHINYMGESMSSC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone?
The IUPAC name of 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone (CID 134788788) is 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone.
What is the SMILES notation for 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone?
The canonical SMILES for 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone is CC(=O)N1CC2(CCCN(C3COC3)C2)Cc2ccccc21.
What is the InChIKey of 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone?
The InChIKey is WGHINYMGESMSSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2/c1-14(21)20-13-18(9-15-5-2-3-6-17(15)20)7-4-8-19(12-18)16-10-22-11-16/h2-3,5-6,16H,4,7-13H2,1H3.
What are the key properties of 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone?
1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone has a molecular weight of 300.40 g/mol, XLogP of 2.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1'-(oxetan-3-yl)spiro[2,4-dihydroquinoline-3,3'-piperidine]-1-yl]ethanone is sourced from PubChem (CID 134788788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).