C26H23ClN2O2 — CID 134788843
1'-(4-chlorobenzoyl)-1-(2-phenylethyl)spiro[indole-3,3'-pyrrolidine]-2-one (PubChem CID 134788843) has the molecular formula C26H23ClN2O2 and a molecular weight of 430.94 g/mol. Its IUPAC name is 1'-(4-chlorobenzoyl)-1-(2-phenylethyl)spiro[indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 1'-(4-chlorobenzoyl)-1-(2-phenylethyl)spiro[indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 134788843 |
| Molecular Formula | C26H23ClN2O2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 1'-(4-chlorobenzoyl)-1-(2-phenylethyl)spiro[indole-3,3'-pyrrolidine]-2-one |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCC2(C1)C(=O)N(CCc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C26H23ClN2O2/c27-21-12-10-20(11-13-21)24(30)28-17-15-26(18-28)22-8-4-5-9-23(22)29(25(26)31)16-14-19-6-2-1-3-7-19/h1-13H,14-18H2 |
| InChIKey | FNOGTHKBZGORSF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |