About 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide
7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide (PubChem CID 134788896) has the molecular formula C10H14N4O2
and a molecular weight of 222.25 g/mol. Its IUPAC name is 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide |
| PubChem CID | 134788896 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide |
| SMILES | CNC(=O)c1cn2c(n1)CN(C(C)=O)CC2 |
| InChI | InChI=1S/C10H14N4O2/c1-7(15)13-3-4-14-5-8(10(16)11-2)12-9(14)6-13/h5H,3-4,6H2,1-2H3,(H,11,16) |
| InChIKey | AGEHYVOUPCHJAY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide?
The IUPAC name of 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide (CID 134788896) is 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide.
What is the SMILES notation for 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide?
The canonical SMILES for 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide is CNC(=O)c1cn2c(n1)CN(C(C)=O)CC2.
What is the InChIKey of 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide?
The InChIKey is AGEHYVOUPCHJAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O2/c1-7(15)13-3-4-14-5-8(10(16)11-2)12-9(14)6-13/h5H,3-4,6H2,1-2H3,(H,11,16).
What are the key properties of 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide?
7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide has a molecular weight of 222.25 g/mol, XLogP of -0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-acetyl-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide is sourced from PubChem (CID 134788896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).