C15H24N6O — CID 134788940
pyrrolidin-1-yl-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone (PubChem CID 134788940) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is pyrrolidin-1-yl-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone.
| Compound Name | pyrrolidin-1-yl-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 134788940 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | pyrrolidin-1-yl-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(N1CCCC1)N1CCCC(c2nnc3n2CCNC3)C1 |
| InChI | InChI=1S/C15H24N6O/c22-15(19-6-1-2-7-19)20-8-3-4-12(11-20)14-18-17-13-10-16-5-9-21(13)14/h12,16H,1-11H2 |
| InChIKey | TWUXUZLWCYNSGE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |