About 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one
1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one (PubChem CID 134789042) has the molecular formula C12H18N4OS
and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one |
| PubChem CID | 134789042 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one |
| SMILES | O=C1NCCN1C1CCN(Cc2cncs2)CC1 |
| InChI | InChI=1S/C12H18N4OS/c17-12-14-3-6-16(12)10-1-4-15(5-2-10)8-11-7-13-9-18-11/h7,9-10H,1-6,8H2,(H,14,17) |
| InChIKey | ZKRMQPYBYBXGPP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one?
The IUPAC name of 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one (CID 134789042) is 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one.
What is the SMILES notation for 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one?
The canonical SMILES for 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one is O=C1NCCN1C1CCN(Cc2cncs2)CC1.
What is the InChIKey of 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one?
The InChIKey is ZKRMQPYBYBXGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4OS/c17-12-14-3-6-16(12)10-1-4-15(5-2-10)8-11-7-13-9-18-11/h7,9-10H,1-6,8H2,(H,14,17).
What are the key properties of 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one?
1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one has a molecular weight of 266.37 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]imidazolidin-2-one is sourced from PubChem (CID 134789042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).