C21H24N4O4 — CID 134789257
N-(2-methoxyethyl)-6-(4-methoxyphenyl)-3-pyrrolidin-3-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 134789257) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-(4-methoxyphenyl)-3-pyrrolidin-3-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-6-(4-methoxyphenyl)-3-pyrrolidin-3-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 134789257 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(2-methoxyethyl)-6-(4-methoxyphenyl)-3-pyrrolidin-3-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | COCCNC(=O)c1cc(-c2ccc(OC)cc2)nc2onc(C3CCNC3)c12 |
| InChI | InChI=1S/C21H24N4O4/c1-27-10-9-23-20(26)16-11-17(13-3-5-15(28-2)6-4-13)24-21-18(16)19(25-29-21)14-7-8-22-12-14/h3-6,11,14,22H,7-10,12H2,1-2H3,(H,23,26) |
| InChIKey | UWHCKYGDZUXXRS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|