About benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate
benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate (PubChem CID 134789527) has the molecular formula C23H22N4O2
and a molecular weight of 386.46 g/mol. Its IUPAC name is benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate |
| PubChem CID | 134789527 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate |
| SMILES | CC(NC(=O)OCc1ccccc1)c1nc2cccnc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H22N4O2/c1-17(25-23(28)29-16-19-11-6-3-7-12-19)21-26-20-13-8-14-24-22(20)27(21)15-18-9-4-2-5-10-18/h2-14,17H,15-16H2,1H3,(H,25,28) |
| InChIKey | MTHSEIIYPTYBIE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate?
The IUPAC name of benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate (CID 134789527) is benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate.
What is the SMILES notation for benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate?
The canonical SMILES for benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate is CC(NC(=O)OCc1ccccc1)c1nc2cccnc2n1Cc1ccccc1.
What is the InChIKey of benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate?
The InChIKey is MTHSEIIYPTYBIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O2/c1-17(25-23(28)29-16-19-11-6-3-7-12-19)21-26-20-13-8-14-24-22(20)27(21)15-18-9-4-2-5-10-18/h2-14,17H,15-16H2,1H3,(H,25,28).
What are the key properties of benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate?
benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate has a molecular weight of 386.46 g/mol, XLogP of 4.47, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[1-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamate is sourced from PubChem (CID 134789527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).