C16H19N3O4S — CID 134789760
1'-(furan-3-ylmethyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,4'-piperidine] 1,1-dioxide (PubChem CID 134789760) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is 1'-(furan-3-ylmethyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,4'-piperidine] 1,1-dioxide.
| Compound Name | 1'-(furan-3-ylmethyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,4'-piperidine] 1,1-dioxide |
|---|---|
| PubChem CID | 134789760 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1'-(furan-3-ylmethyl)spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,4'-piperidine] 1,1-dioxide |
| SMILES | O=S1(=O)NCC2(CCN(Cc3ccoc3)CC2)Oc2ncccc21 |
| InChI | InChI=1S/C16H19N3O4S/c20-24(21)14-2-1-6-17-15(14)23-16(12-18-24)4-7-19(8-5-16)10-13-3-9-22-11-13/h1-3,6,9,11,18H,4-5,7-8,10,12H2 |
| InChIKey | CQGQHMXDSNUABY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |