C13H15ClF3N3 — CID 134790240
3-(6-chloro-2-pyridinyl)-8-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane (PubChem CID 134790240) has the molecular formula C13H15ClF3N3 and a molecular weight of 305.73 g/mol. Its IUPAC name is 3-(6-chloro-2-pyridinyl)-8-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 3-(6-chloro-2-pyridinyl)-8-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 134790240 |
| Molecular Formula | C13H15ClF3N3 |
| Molecular Weight | 305.73 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-(6-chloro-2-pyridinyl)-8-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane |
| SMILES | FC(F)(F)CN1C2CCC1CN(c1cccc(Cl)n1)C2 |
| InChI | InChI=1S/C13H15ClF3N3/c14-11-2-1-3-12(18-11)19-6-9-4-5-10(7-19)20(9)8-13(15,16)17/h1-3,9-10H,4-8H2 |
| InChIKey | GTSNUFHJBVNWRY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|