C21H27N3O5S — CID 134790259
CID 134790259 (PubChem CID 134790259) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol.
| Compound Name | CID 134790259 |
|---|---|
| PubChem CID | 134790259 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | — |
| SMILES | Cc1noc(C)c1CC(=O)N1Cc2ccccc2OC2(CCN([S+](C)(=O)[O-])CC2)C1 |
| InChI | InChI=1S/C21H27N3O5S/c1-15-18(16(2)29-22-15)12-20(25)23-13-17-6-4-5-7-19(17)28-21(14-23)8-10-24(11-9-21)30(3,26)27/h4-7H,8-14H2,1-3H3 |
| InChIKey | YLOCJDXYBDLEIK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|