C12H16N4O2 — CID 134790322
7-acetyl-N-prop-2-enyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide (PubChem CID 134790322) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 7-acetyl-N-prop-2-enyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | 7-acetyl-N-prop-2-enyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 134790322 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 7-acetyl-N-prop-2-enyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide |
| SMILES | C=CCNC(=O)c1cn2c(n1)CN(C(C)=O)CC2 |
| InChI | InChI=1S/C12H16N4O2/c1-3-4-13-12(18)10-7-16-6-5-15(9(2)17)8-11(16)14-10/h3,7H,1,4-6,8H2,2H3,(H,13,18) |
| InChIKey | QWGUBGUZUYMGAX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|