C20H23N5 — CID 134790407
N,N-dimethyl-4-[(3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]aniline (PubChem CID 134790407) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[(3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]aniline.
| Compound Name | N,N-dimethyl-4-[(3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]aniline |
|---|---|
| PubChem CID | 134790407 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | N,N-dimethyl-4-[(3-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methyl]aniline |
| SMILES | CN(C)c1ccc(CN2CCn3c(nnc3-c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H23N5/c1-23(2)18-10-8-16(9-11-18)14-24-12-13-25-19(15-24)21-22-20(25)17-6-4-3-5-7-17/h3-11H,12-15H2,1-2H3 |
| InChIKey | KAEVGNNEYKFLEL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|